C23H27N7OS — CID 143728199
4-[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]phenyl]sulfanyl-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine (PubChem CID 143728199) has the molecular formula C23H27N7OS and a molecular weight of 449.58 g/mol. Its IUPAC name is 4-[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]phenyl]sulfanyl-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]phenyl]sulfanyl-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 143728199 |
| Molecular Formula | C23H27N7OS |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 4-[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]phenyl]sulfanyl-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
| SMILES | N/C=C\N(N)Cc1ccc(Sc2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C23H27N7OS/c24-10-12-30(25)17-18-1-7-21(8-2-18)32-22-9-11-26-23(28-22)27-19-3-5-20(6-4-19)29-13-15-31-16-14-29/h1-12H,13-17,24-25H2,(H,26,27,28)/b12-10- |
| InChIKey | AOVRZVVCUVGXLV-BENRWUELSA-N |
| XLogP | 3.31 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|