C23H22ClN5O2S — CID 59491739
(Z)-3-chloro-N-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide (PubChem CID 59491739) has the molecular formula C23H22ClN5O2S and a molecular weight of 467.98 g/mol. Its IUPAC name is (Z)-3-chloro-N-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide.
| Compound Name | (Z)-3-chloro-N-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59491739 |
| Molecular Formula | C23H22ClN5O2S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (Z)-3-chloro-N-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
| SMILES | O=C(/C=C\Cl)Nc1ccc(Sc2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C23H22ClN5O2S/c24-11-9-21(30)26-17-3-7-20(8-4-17)32-22-10-12-25-23(28-22)27-18-1-5-19(6-2-18)29-13-15-31-16-14-29/h1-12H,13-16H2,(H,26,30)(H,25,27,28)/b11-9- |
| InChIKey | BQBJLUMVNUSKQT-LUAWRHEFSA-N |
| XLogP | 4.90 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|