C26H28N6O2S — CID 59491549
N-[4-[2-(4-morpholin-4-ylanilino)-6-(prop-2-enylamino)pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide (PubChem CID 59491549) has the molecular formula C26H28N6O2S and a molecular weight of 488.62 g/mol. Its IUPAC name is N-[4-[2-(4-morpholin-4-ylanilino)-6-(prop-2-enylamino)pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide.
| Compound Name | N-[4-[2-(4-morpholin-4-ylanilino)-6-(prop-2-enylamino)pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59491549 |
| Molecular Formula | C26H28N6O2S |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-[4-[2-(4-morpholin-4-ylanilino)-6-(prop-2-enylamino)pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
| SMILES | C=CCNc1cc(Sc2ccc(NC(=O)C=C)cc2)nc(Nc2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C26H28N6O2S/c1-3-13-27-23-18-25(35-22-11-7-19(8-12-22)28-24(33)4-2)31-26(30-23)29-20-5-9-21(10-6-20)32-14-16-34-17-15-32/h3-12,18H,1-2,13-17H2,(H,28,33)(H2,27,29,30,31) |
| InChIKey | SOKQAICEGHJGLJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|