C24H23ClN4O2S — CID 146873375
(E)-3-chloro-N-[3-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide (PubChem CID 146873375) has the molecular formula C24H23ClN4O2S and a molecular weight of 466.99 g/mol. Its IUPAC name is (E)-3-chloro-N-[3-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide.
| Compound Name | (E)-3-chloro-N-[3-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146873375 |
| Molecular Formula | C24H23ClN4O2S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | (E)-3-chloro-N-[3-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
| SMILES | O=C(/C=C/Cl)Nc1cccc(Sc2ccnc(Cc3ccc(N4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C24H23ClN4O2S/c25-10-8-23(30)27-19-2-1-3-21(17-19)32-24-9-11-26-22(28-24)16-18-4-6-20(7-5-18)29-12-14-31-15-13-29/h1-11,17H,12-16H2,(H,27,30)/b10-8+ |
| InChIKey | SOTCZJURSIESAO-CSKARUKUSA-N |
| XLogP | 4.75 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|