C22H21N7OS — CID 158128104
4-[4-[[4-[4-(tetrazol-1-yl)phenyl]sulfanylpyrimidin-2-yl]methyl]phenyl]morpholine (PubChem CID 158128104) has the molecular formula C22H21N7OS and a molecular weight of 431.53 g/mol. Its IUPAC name is 4-[4-[[4-[4-(tetrazol-1-yl)phenyl]sulfanylpyrimidin-2-yl]methyl]phenyl]morpholine.
| Compound Name | 4-[4-[[4-[4-(tetrazol-1-yl)phenyl]sulfanylpyrimidin-2-yl]methyl]phenyl]morpholine |
|---|---|
| PubChem CID | 158128104 |
| Molecular Formula | C22H21N7OS |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-[4-[[4-[4-(tetrazol-1-yl)phenyl]sulfanylpyrimidin-2-yl]methyl]phenyl]morpholine |
| SMILES | c1cc(Sc2ccc(-n3cnnn3)cc2)nc(Cc2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C22H21N7OS/c1-3-18(28-11-13-30-14-12-28)4-2-17(1)15-21-23-10-9-22(25-21)31-20-7-5-19(6-8-20)29-16-24-26-27-29/h1-10,16H,11-15H2 |
| InChIKey | FSKZCFOLGGFLJF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 81.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|