C26H28N4O2S — CID 160817173
(E)-2-methyl-N-[3-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]but-2-enamide (PubChem CID 160817173) has the molecular formula C26H28N4O2S and a molecular weight of 460.60 g/mol. Its IUPAC name is (E)-2-methyl-N-[3-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]but-2-enamide.
| Compound Name | (E)-2-methyl-N-[3-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]but-2-enamide |
|---|---|
| PubChem CID | 160817173 |
| Molecular Formula | C26H28N4O2S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (E)-2-methyl-N-[3-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]but-2-enamide |
| SMILES | C/C=C(\C)C(=O)Nc1cccc(Sc2ccnc(Cc3ccc(N4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C26H28N4O2S/c1-3-19(2)26(31)28-21-5-4-6-23(18-21)33-25-11-12-27-24(29-25)17-20-7-9-22(10-8-20)30-13-15-32-16-14-30/h3-12,18H,13-17H2,1-2H3,(H,28,31)/b19-3+ |
| InChIKey | SFAZBXBRILSNHX-QBROUFQSSA-N |
| XLogP | 4.96 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|