C24H24N4O3S — CID 161282710
N-[3-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]-2-oxopropanamide (PubChem CID 161282710) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[3-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]-2-oxopropanamide.
| Compound Name | N-[3-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]-2-oxopropanamide |
|---|---|
| PubChem CID | 161282710 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[3-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]-2-oxopropanamide |
| SMILES | CC(=O)C(=O)Nc1cccc(Sc2ccnc(Cc3ccc(N4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C24H24N4O3S/c1-17(29)24(30)26-19-3-2-4-21(16-19)32-23-9-10-25-22(27-23)15-18-5-7-20(8-6-18)28-11-13-31-14-12-28/h2-10,16H,11-15H2,1H3,(H,26,30) |
| InChIKey | VFHMRUYTGNJOCN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|