C25H26N4O3S — CID 161009849
N-[2-methoxy-4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide (PubChem CID 161009849) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[2-methoxy-4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide.
| Compound Name | N-[2-methoxy-4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 161009849 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[2-methoxy-4-[2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Sc2ccnc(Cc3ccc(N4CCOCC4)cc3)n2)cc1OC |
| InChI | InChI=1S/C25H26N4O3S/c1-3-24(30)27-21-9-8-20(17-22(21)31-2)33-25-10-11-26-23(28-25)16-18-4-6-19(7-5-18)29-12-14-32-15-13-29/h3-11,17H,1,12-16H2,2H3,(H,27,30) |
| InChIKey | TWZIHWSXVRVENZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|