C26H26N4O4S — CID 149173125
(E)-4-[4-[5-methyl-2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 149173125) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is (E)-4-[4-[5-methyl-2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[5-methyl-2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 149173125 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (E)-4-[4-[5-methyl-2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | Cc1cnc(Cc2ccc(N3CCOCC3)cc2)nc1Sc1ccc(NC(=O)/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C26H26N4O4S/c1-18-17-27-23(16-19-2-6-21(7-3-19)30-12-14-34-15-13-30)29-26(18)35-22-8-4-20(5-9-22)28-24(31)10-11-25(32)33/h2-11,17H,12-16H2,1H3,(H,28,31)(H,32,33)/b11-10+ |
| InChIKey | WZLMEWCFLSQCLA-ZHACJKMWSA-N |
| XLogP | 3.94 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|