C25H25N5O3S — CID 91392705
1-[4-[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]pyrrole-2,5-diol (PubChem CID 91392705) has the molecular formula C25H25N5O3S and a molecular weight of 475.57 g/mol. Its IUPAC name is 1-[4-[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]pyrrole-2,5-diol.
| Compound Name | 1-[4-[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91392705 |
| Molecular Formula | C25H25N5O3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 1-[4-[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]pyrrole-2,5-diol |
| SMILES | Cc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1Sc1ccc(-n2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C25H25N5O3S/c1-17-16-26-25(27-18-2-4-19(5-3-18)29-12-14-33-15-13-29)28-24(17)34-21-8-6-20(7-9-21)30-22(31)10-11-23(30)32/h2-11,16,31-32H,12-15H2,1H3,(H,26,27,28) |
| InChIKey | XOSFWLBJJDLJJU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|