C26H30N6O3S — CID 59491687
N-methyl-N'-[4-[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]butanediamide (PubChem CID 59491687) has the molecular formula C26H30N6O3S and a molecular weight of 506.63 g/mol. Its IUPAC name is N-methyl-N'-[4-[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]butanediamide.
| Compound Name | N-methyl-N'-[4-[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]butanediamide |
|---|---|
| PubChem CID | 59491687 |
| Molecular Formula | C26H30N6O3S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | N-methyl-N'-[4-[5-methyl-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]butanediamide |
| SMILES | CNC(=O)CCC(=O)Nc1ccc(Sc2nc(Nc3ccc(N4CCOCC4)cc3)ncc2C)cc1 |
| InChI | InChI=1S/C26H30N6O3S/c1-18-17-28-26(30-20-3-7-21(8-4-20)32-13-15-35-16-14-32)31-25(18)36-22-9-5-19(6-10-22)29-24(34)12-11-23(33)27-2/h3-10,17H,11-16H2,1-2H3,(H,27,33)(H,29,34)(H,28,30,31) |
| InChIKey | AJNUSCPKPKLXAI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|