C25H25BrN4O2S — CID 158947172
N-[4-[5-bromo-2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]-N-methylprop-2-enamide (PubChem CID 158947172) has the molecular formula C25H25BrN4O2S and a molecular weight of 525.47 g/mol. Its IUPAC name is N-[4-[5-bromo-2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]-N-methylprop-2-enamide.
| Compound Name | N-[4-[5-bromo-2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 158947172 |
| Molecular Formula | C25H25BrN4O2S |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | N-[4-[5-bromo-2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]sulfanylphenyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccc(Sc2nc(Cc3ccc(N4CCOCC4)cc3)ncc2Br)cc1 |
| InChI | InChI=1S/C25H25BrN4O2S/c1-3-24(31)29(2)19-8-10-21(11-9-19)33-25-22(26)17-27-23(28-25)16-18-4-6-20(7-5-18)30-12-14-32-15-13-30/h3-11,17H,1,12-16H2,2H3 |
| InChIKey | JKYTWPDXEFYNKT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|