C24H22ClN5O2 — CID 159699553
4-[5-chloro-2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]-N-(cyanomethyl)benzamide (PubChem CID 159699553) has the molecular formula C24H22ClN5O2 and a molecular weight of 447.93 g/mol. Its IUPAC name is 4-[5-chloro-2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]-N-(cyanomethyl)benzamide.
| Compound Name | 4-[5-chloro-2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]-N-(cyanomethyl)benzamide |
|---|---|
| PubChem CID | 159699553 |
| Molecular Formula | C24H22ClN5O2 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 4-[5-chloro-2-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]-N-(cyanomethyl)benzamide |
| SMILES | N#CCNC(=O)c1ccc(-c2nc(Cc3ccc(N4CCOCC4)cc3)ncc2Cl)cc1 |
| InChI | InChI=1S/C24H22ClN5O2/c25-21-16-28-22(15-17-1-7-20(8-2-17)30-11-13-32-14-12-30)29-23(21)18-3-5-19(6-4-18)24(31)27-10-9-26/h1-8,16H,10-15H2,(H,27,31) |
| InChIKey | MXLGLGVTOFPZIR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|