C24H23N5OS — CID 158723747
N-(cyanomethyl)-4-[2-[(4-thiomorpholin-4-ylphenyl)methyl]pyrimidin-4-yl]benzamide (PubChem CID 158723747) has the molecular formula C24H23N5OS and a molecular weight of 429.55 g/mol. Its IUPAC name is N-(cyanomethyl)-4-[2-[(4-thiomorpholin-4-ylphenyl)methyl]pyrimidin-4-yl]benzamide.
| Compound Name | N-(cyanomethyl)-4-[2-[(4-thiomorpholin-4-ylphenyl)methyl]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 158723747 |
| Molecular Formula | C24H23N5OS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | N-(cyanomethyl)-4-[2-[(4-thiomorpholin-4-ylphenyl)methyl]pyrimidin-4-yl]benzamide |
| SMILES | N#CCNC(=O)c1ccc(-c2ccnc(Cc3ccc(N4CCSCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C24H23N5OS/c25-10-12-27-24(30)20-5-3-19(4-6-20)22-9-11-26-23(28-22)17-18-1-7-21(8-2-18)29-13-15-31-16-14-29/h1-9,11H,12-17H2,(H,27,30) |
| InChIKey | IKFUHVRXKDWFFQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|