C22H24N6OS — CID 70864429
N-(aminomethyl)-4-[2-(4-thiomorpholin-4-ylanilino)pyrimidin-4-yl]benzamide (PubChem CID 70864429) has the molecular formula C22H24N6OS and a molecular weight of 420.54 g/mol. Its IUPAC name is N-(aminomethyl)-4-[2-(4-thiomorpholin-4-ylanilino)pyrimidin-4-yl]benzamide.
| Compound Name | N-(aminomethyl)-4-[2-(4-thiomorpholin-4-ylanilino)pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 70864429 |
| Molecular Formula | C22H24N6OS |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-(aminomethyl)-4-[2-(4-thiomorpholin-4-ylanilino)pyrimidin-4-yl]benzamide |
| SMILES | NCNC(=O)c1ccc(-c2ccnc(Nc3ccc(N4CCSCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C22H24N6OS/c23-15-25-21(29)17-3-1-16(2-4-17)20-9-10-24-22(27-20)26-18-5-7-19(8-6-18)28-11-13-30-14-12-28/h1-10H,11-15,23H2,(H,25,29)(H,24,26,27) |
| InChIKey | SJCGIWHRVUOGEW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|