C24H22N6O2 — CID 72715086
N-(cyanomethyl)-4-[2-[4-(6-oxa-3-azabicyclo[3.1.1]heptan-3-yl)anilino]pyrimidin-4-yl]benzamide (PubChem CID 72715086) has the molecular formula C24H22N6O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-(cyanomethyl)-4-[2-[4-(6-oxa-3-azabicyclo[3.1.1]heptan-3-yl)anilino]pyrimidin-4-yl]benzamide.
| Compound Name | N-(cyanomethyl)-4-[2-[4-(6-oxa-3-azabicyclo[3.1.1]heptan-3-yl)anilino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 72715086 |
| Molecular Formula | C24H22N6O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-(cyanomethyl)-4-[2-[4-(6-oxa-3-azabicyclo[3.1.1]heptan-3-yl)anilino]pyrimidin-4-yl]benzamide |
| SMILES | N#CCNC(=O)c1ccc(-c2ccnc(Nc3ccc(N4CC5CC(C4)O5)cc3)n2)cc1 |
| InChI | InChI=1S/C24H22N6O2/c25-10-12-26-23(31)17-3-1-16(2-4-17)22-9-11-27-24(29-22)28-18-5-7-19(8-6-18)30-14-20-13-21(15-30)32-20/h1-9,11,20-21H,12-15H2,(H,26,31)(H,27,28,29) |
| InChIKey | TVRMUOGUIBQRQC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|