C25H23FN6O3S — CID 91124452
O-(fluoromethyl) 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzenecarbothioate (PubChem CID 91124452) has the molecular formula C25H23FN6O3S and a molecular weight of 506.56 g/mol. Its IUPAC name is O-(fluoromethyl) 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzenecarbothioate.
| Compound Name | O-(fluoromethyl) 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzenecarbothioate |
|---|---|
| PubChem CID | 91124452 |
| Molecular Formula | C25H23FN6O3S |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | O-(fluoromethyl) 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzenecarbothioate |
| SMILES | N#CCNC(=O)c1ccc(-c2ccnc(Nc3ccc(N4CCOCC4)c(C(=S)OCF)c3)n2)cc1 |
| InChI | InChI=1S/C25H23FN6O3S/c26-16-35-24(36)20-15-19(5-6-22(20)32-11-13-34-14-12-32)30-25-29-9-7-21(31-25)17-1-3-18(4-2-17)23(33)28-10-8-27/h1-7,9,15H,10-14,16H2,(H,28,33)(H,29,30,31) |
| InChIKey | IDILCXRRCZOGIF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|