C28H28N6O4 — CID 87601400
cyclobutyl 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoate (PubChem CID 87601400) has the molecular formula C28H28N6O4 and a molecular weight of 512.57 g/mol. Its IUPAC name is cyclobutyl 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoate.
| Compound Name | cyclobutyl 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 87601400 |
| Molecular Formula | C28H28N6O4 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | cyclobutyl 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoate |
| SMILES | N#CCNC(=O)c1ccc(-c2ccnc(Nc3ccc(N4CCOCC4)c(C(=O)OC4CCC4)c3)n2)cc1 |
| InChI | InChI=1S/C28H28N6O4/c29-11-13-30-26(35)20-6-4-19(5-7-20)24-10-12-31-28(33-24)32-21-8-9-25(34-14-16-37-17-15-34)23(18-21)27(36)38-22-2-1-3-22/h4-10,12,18,22H,1-3,13-17H2,(H,30,35)(H,31,32,33) |
| InChIKey | KAKNASGUQTVOQL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|