C30H32N6O5 — CID 25215249
oxan-4-yl 5-[[4-[4-[cyano(methyl)carbamoyl]phenyl]-5-methylpyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoate (PubChem CID 25215249) has the molecular formula C30H32N6O5 and a molecular weight of 556.62 g/mol. Its IUPAC name is oxan-4-yl 5-[[4-[4-[cyano(methyl)carbamoyl]phenyl]-5-methylpyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoate.
| Compound Name | oxan-4-yl 5-[[4-[4-[cyano(methyl)carbamoyl]phenyl]-5-methylpyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 25215249 |
| Molecular Formula | C30H32N6O5 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | oxan-4-yl 5-[[4-[4-[cyano(methyl)carbamoyl]phenyl]-5-methylpyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoate |
| SMILES | Cc1cnc(Nc2ccc(N3CCOCC3)c(C(=O)OC3CCOCC3)c2)nc1-c1ccc(C(=O)N(C)C#N)cc1 |
| InChI | InChI=1S/C30H32N6O5/c1-20-18-32-30(34-27(20)21-3-5-22(6-4-21)28(37)35(2)19-31)33-23-7-8-26(36-11-15-40-16-12-36)25(17-23)29(38)41-24-9-13-39-14-10-24/h3-8,17-18,24H,9-16H2,1-2H3,(H,32,33,34) |
| InChIKey | UERMQPWCROGACM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|