C25H24N6O3S — CID 87602363
5-[[4-[4-(cyanomethylcarbamoyl)phenyl]-5-methylpyrimidin-2-yl]amino]-2-morpholin-4-ylbenzenecarbothioic S-acid (PubChem CID 87602363) has the molecular formula C25H24N6O3S and a molecular weight of 488.57 g/mol. Its IUPAC name is 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]-5-methylpyrimidin-2-yl]amino]-2-morpholin-4-ylbenzenecarbothioic S-acid.
| Compound Name | 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]-5-methylpyrimidin-2-yl]amino]-2-morpholin-4-ylbenzenecarbothioic S-acid |
|---|---|
| PubChem CID | 87602363 |
| Molecular Formula | C25H24N6O3S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]-5-methylpyrimidin-2-yl]amino]-2-morpholin-4-ylbenzenecarbothioic S-acid |
| SMILES | Cc1cnc(Nc2ccc(N3CCOCC3)c(C(=O)S)c2)nc1-c1ccc(C(=O)NCC#N)cc1 |
| InChI | InChI=1S/C25H24N6O3S/c1-16-15-28-25(30-22(16)17-2-4-18(5-3-17)23(32)27-9-8-26)29-19-6-7-21(20(14-19)24(33)35)31-10-12-34-13-11-31/h2-7,14-15H,9-13H2,1H3,(H,27,32)(H,33,35)(H,28,29,30) |
| InChIKey | UFKSUWZWHWLDPF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|