C27H28N6O4 — CID 87602514
propan-2-yl 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoate (PubChem CID 87602514) has the molecular formula C27H28N6O4 and a molecular weight of 500.56 g/mol. Its IUPAC name is propan-2-yl 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoate.
| Compound Name | propan-2-yl 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 87602514 |
| Molecular Formula | C27H28N6O4 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | propan-2-yl 5-[[4-[4-(cyanomethylcarbamoyl)phenyl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoate |
| SMILES | CC(C)OC(=O)c1cc(Nc2nccc(-c3ccc(C(=O)NCC#N)cc3)n2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C27H28N6O4/c1-18(2)37-26(35)22-17-21(7-8-24(22)33-13-15-36-16-14-33)31-27-30-11-9-23(32-27)19-3-5-20(6-4-19)25(34)29-12-10-28/h3-9,11,17-18H,12-16H2,1-2H3,(H,29,34)(H,30,31,32) |
| InChIKey | RHSXRHZFHSGCIP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|