C29H30N6O3S — CID 25212544
N-(cyanomethyl)-4-[2-[4-[4-[(2-oxooxolan-3-yl)sulfanylmethyl]piperidin-1-yl]anilino]pyrimidin-4-yl]benzamide (PubChem CID 25212544) has the molecular formula C29H30N6O3S and a molecular weight of 542.67 g/mol. Its IUPAC name is N-(cyanomethyl)-4-[2-[4-[4-[(2-oxooxolan-3-yl)sulfanylmethyl]piperidin-1-yl]anilino]pyrimidin-4-yl]benzamide.
| Compound Name | N-(cyanomethyl)-4-[2-[4-[4-[(2-oxooxolan-3-yl)sulfanylmethyl]piperidin-1-yl]anilino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 25212544 |
| Molecular Formula | C29H30N6O3S |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | N-(cyanomethyl)-4-[2-[4-[4-[(2-oxooxolan-3-yl)sulfanylmethyl]piperidin-1-yl]anilino]pyrimidin-4-yl]benzamide |
| SMILES | N#CCNC(=O)c1ccc(-c2ccnc(Nc3ccc(N4CCC(CSC5CCOC5=O)CC4)cc3)n2)cc1 |
| InChI | InChI=1S/C29H30N6O3S/c30-13-15-31-27(36)22-3-1-21(2-4-22)25-9-14-32-29(34-25)33-23-5-7-24(8-6-23)35-16-10-20(11-17-35)19-39-26-12-18-38-28(26)37/h1-9,14,20,26H,10-12,15-19H2,(H,31,36)(H,32,33,34) |
| InChIKey | LUTYPRCBWVIUBN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|