C19H14IN5O — CID 25061687
N-(cyanomethyl)-4-[2-(4-iodoanilino)pyrimidin-4-yl]benzamide (PubChem CID 25061687) has the molecular formula C19H14IN5O and a molecular weight of 455.26 g/mol. Its IUPAC name is N-(cyanomethyl)-4-[2-(4-iodoanilino)pyrimidin-4-yl]benzamide.
| Compound Name | N-(cyanomethyl)-4-[2-(4-iodoanilino)pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 25061687 |
| Molecular Formula | C19H14IN5O |
| Molecular Weight | 455.26 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | N-(cyanomethyl)-4-[2-(4-iodoanilino)pyrimidin-4-yl]benzamide |
| SMILES | N#CCNC(=O)c1ccc(-c2ccnc(Nc3ccc(I)cc3)n2)cc1 |
| InChI | InChI=1S/C19H14IN5O/c20-15-5-7-16(8-6-15)24-19-23-11-9-17(25-19)13-1-3-14(4-2-13)18(26)22-12-10-21/h1-9,11H,12H2,(H,22,26)(H,23,24,25) |
| InChIKey | FBGQWQKPPNXFPL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|