C30H34N8O4 — CID 145473426
5-[[4-[4-[cyanomethyl(2-oxopropanoyl)amino]phenyl]pyrimidin-2-yl]amino]-N-[2-(dimethylamino)ethyl]-2-morpholin-4-ylbenzamide (PubChem CID 145473426) has the molecular formula C30H34N8O4 and a molecular weight of 570.65 g/mol. Its IUPAC name is 5-[[4-[4-[cyanomethyl(2-oxopropanoyl)amino]phenyl]pyrimidin-2-yl]amino]-N-[2-(dimethylamino)ethyl]-2-morpholin-4-ylbenzamide.
| Compound Name | 5-[[4-[4-[cyanomethyl(2-oxopropanoyl)amino]phenyl]pyrimidin-2-yl]amino]-N-[2-(dimethylamino)ethyl]-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 145473426 |
| Molecular Formula | C30H34N8O4 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | 5-[[4-[4-[cyanomethyl(2-oxopropanoyl)amino]phenyl]pyrimidin-2-yl]amino]-N-[2-(dimethylamino)ethyl]-2-morpholin-4-ylbenzamide |
| SMILES | CC(=O)C(=O)N(CC#N)c1ccc(-c2ccnc(Nc3ccc(N4CCOCC4)c(C(=O)NCCN(C)C)c3)n2)cc1 |
| InChI | InChI=1S/C30H34N8O4/c1-21(39)29(41)38(14-11-31)24-7-4-22(5-8-24)26-10-12-33-30(35-26)34-23-6-9-27(37-16-18-42-19-17-37)25(20-23)28(40)32-13-15-36(2)3/h4-10,12,20H,13-19H2,1-3H3,(H,32,40)(H,33,34,35) |
| InChIKey | LVRZPADKPNBOSI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|