C28H27AsN5O4 — CID 87638303
CID 87638303 (PubChem CID 87638303) has the molecular formula C28H27AsN5O4 and a molecular weight of 572.48 g/mol.
| Compound Name | CID 87638303 |
|---|---|
| PubChem CID | 87638303 |
| Molecular Formula | C28H27AsN5O4 |
| Molecular Weight | 572.48 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | — |
| SMILES | CN(C#N)C(=O)c1ccc(-c2ccnc([As]c3ccc(N4CCOCC4)c(C(=O)OC4CCC4)c3)n2)cc1 |
| InChI | InChI=1S/C28H27AsN5O4/c1-33(18-30)26(35)20-7-5-19(6-8-20)24-11-12-31-28(32-24)29-21-9-10-25(34-13-15-37-16-14-34)23(17-21)27(36)38-22-3-2-4-22/h5-12,17,22H,2-4,13-16H2,1H3 |
| InChIKey | VSLNEURZNGVIRN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 108.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|