C25H25FN6O3S — CID 143771170
4-(2-aminopyrimidin-4-yl)-N-(cyanomethyl)benzamide;S-(fluoromethyl) 2-morpholin-4-ylbenzenecarbothioate (PubChem CID 143771170) has the molecular formula C25H25FN6O3S and a molecular weight of 508.58 g/mol. Its IUPAC name is 4-(2-aminopyrimidin-4-yl)-N-(cyanomethyl)benzamide;S-(fluoromethyl) 2-morpholin-4-ylbenzenecarbothioate.
| Compound Name | 4-(2-aminopyrimidin-4-yl)-N-(cyanomethyl)benzamide;S-(fluoromethyl) 2-morpholin-4-ylbenzenecarbothioate |
|---|---|
| PubChem CID | 143771170 |
| Molecular Formula | C25H25FN6O3S |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 4-(2-aminopyrimidin-4-yl)-N-(cyanomethyl)benzamide;S-(fluoromethyl) 2-morpholin-4-ylbenzenecarbothioate |
| SMILES | N#CCNC(=O)c1ccc(-c2ccnc(N)n2)cc1.O=C(SCF)c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C13H11N5O.C12H14FNO2S/c14-6-8-16-12(19)10-3-1-9(2-4-10)11-5-7-17-13(15)18-11;13-9-17-12(15)10-3-1-2-4-11(10)14-5-7-16-8-6-14/h1-5,7H,8H2,(H,16,19)(H2,15,17,18);1-4H,5-9H2 |
| InChIKey | ZWVWOBVNAWEJFM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|