C23H22N6O2S — CID 25061684
N-(cyanomethyl)-4-[2-[morpholin-4-yl-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)amino]pyrimidin-4-yl]benzamide (PubChem CID 25061684) has the molecular formula C23H22N6O2S and a molecular weight of 446.54 g/mol. Its IUPAC name is N-(cyanomethyl)-4-[2-[morpholin-4-yl-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)amino]pyrimidin-4-yl]benzamide.
| Compound Name | N-(cyanomethyl)-4-[2-[morpholin-4-yl-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)amino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 25061684 |
| Molecular Formula | C23H22N6O2S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-(cyanomethyl)-4-[2-[morpholin-4-yl-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)amino]pyrimidin-4-yl]benzamide |
| SMILES | N#CCNC(=O)c1ccc(-c2ccnc(N(C3=CCC(=S)C=C3)N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C23H22N6O2S/c24-10-12-25-22(30)18-3-1-17(2-4-18)21-9-11-26-23(27-21)29(28-13-15-31-16-14-28)19-5-7-20(32)8-6-19/h1-7,9,11H,8,12-16H2,(H,25,30) |
| InChIKey | RMIKTPKXEVECAD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|