C26H23N5O2S — CID 58228974
N-(cyanomethyl)-4-[2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidin-7-yl]benzamide (PubChem CID 58228974) has the molecular formula C26H23N5O2S and a molecular weight of 469.57 g/mol. Its IUPAC name is N-(cyanomethyl)-4-[2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidin-7-yl]benzamide.
| Compound Name | N-(cyanomethyl)-4-[2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidin-7-yl]benzamide |
|---|---|
| PubChem CID | 58228974 |
| Molecular Formula | C26H23N5O2S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | N-(cyanomethyl)-4-[2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidin-7-yl]benzamide |
| SMILES | N#CCNC(=O)c1ccc(-c2csc3cnc(Cc4ccc(N5CCOCC5)cc4)nc23)cc1 |
| InChI | InChI=1S/C26H23N5O2S/c27-9-10-28-26(32)20-5-3-19(4-6-20)22-17-34-23-16-29-24(30-25(22)23)15-18-1-7-21(8-2-18)31-11-13-33-14-12-31/h1-8,16-17H,10-15H2,(H,28,32) |
| InChIKey | XWLIQEKHOIGXKD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|