C27H29N5O3S — CID 58228944
1-ethyl-3-[2-methoxy-4-[2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidin-7-yl]phenyl]urea (PubChem CID 58228944) has the molecular formula C27H29N5O3S and a molecular weight of 503.63 g/mol. Its IUPAC name is 1-ethyl-3-[2-methoxy-4-[2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidin-7-yl]phenyl]urea.
| Compound Name | 1-ethyl-3-[2-methoxy-4-[2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidin-7-yl]phenyl]urea |
|---|---|
| PubChem CID | 58228944 |
| Molecular Formula | C27H29N5O3S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 1-ethyl-3-[2-methoxy-4-[2-[(4-morpholin-4-ylphenyl)methyl]thieno[3,2-d]pyrimidin-7-yl]phenyl]urea |
| SMILES | CCNC(=O)Nc1ccc(-c2csc3cnc(Cc4ccc(N5CCOCC5)cc4)nc23)cc1OC |
| InChI | InChI=1S/C27H29N5O3S/c1-3-28-27(33)30-22-9-6-19(15-23(22)34-2)21-17-36-24-16-29-25(31-26(21)24)14-18-4-7-20(8-5-18)32-10-12-35-13-11-32/h4-9,15-17H,3,10-14H2,1-2H3,(H2,28,30,33) |
| InChIKey | NNHJTQDMHKIHSQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|