C23H23N5O3S2 — CID 146619869
4-[4-[[7-[4-[(sulfinoamino)methyl]phenyl]thieno[3,2-d]pyrimidin-2-yl]amino]phenyl]morpholine (PubChem CID 146619869) has the molecular formula C23H23N5O3S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 4-[4-[[7-[4-[(sulfinoamino)methyl]phenyl]thieno[3,2-d]pyrimidin-2-yl]amino]phenyl]morpholine.
| Compound Name | 4-[4-[[7-[4-[(sulfinoamino)methyl]phenyl]thieno[3,2-d]pyrimidin-2-yl]amino]phenyl]morpholine |
|---|---|
| PubChem CID | 146619869 |
| Molecular Formula | C23H23N5O3S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 4-[4-[[7-[4-[(sulfinoamino)methyl]phenyl]thieno[3,2-d]pyrimidin-2-yl]amino]phenyl]morpholine |
| SMILES | O=S(O)NCc1ccc(-c2csc3cnc(Nc4ccc(N5CCOCC5)cc4)nc23)cc1 |
| InChI | InChI=1S/C23H23N5O3S2/c29-33(30)25-13-16-1-3-17(4-2-16)20-15-32-21-14-24-23(27-22(20)21)26-18-5-7-19(8-6-18)28-9-11-31-12-10-28/h1-8,14-15,25H,9-13H2,(H,29,30)(H,24,26,27) |
| InChIKey | LOGDKLQOVJKONO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|