C27H30N6O2S2 — CID 164620981
7-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine (PubChem CID 164620981) has the molecular formula C27H30N6O2S2 and a molecular weight of 534.71 g/mol. Its IUPAC name is 7-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine.
| Compound Name | 7-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 164620981 |
| Molecular Formula | C27H30N6O2S2 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 7-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine |
| SMILES | CCN1CCN(c2ccc(Nc3ncc4scc(-c5cccc(N6CCCS6(=O)=O)c5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C27H30N6O2S2/c1-2-31-12-14-32(15-13-31)22-9-7-21(8-10-22)29-27-28-18-25-26(30-27)24(19-36-25)20-5-3-6-23(17-20)33-11-4-16-37(33,34)35/h3,5-10,17-19H,2,4,11-16H2,1H3,(H,28,29,30) |
| InChIKey | GHCSYNVJDJYJNG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|