C23H24BrN7S — CID 91036521
4-N-(1,3-benzothiazol-5-yl)-5-bromo-2-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 91036521) has the molecular formula C23H24BrN7S and a molecular weight of 510.47 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-5-yl)-5-bromo-2-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,3-benzothiazol-5-yl)-5-bromo-2-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91036521 |
| Molecular Formula | C23H24BrN7S |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 4-N-(1,3-benzothiazol-5-yl)-5-bromo-2-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CCN1CCN(c2ccc(Nc3ncc(Br)c(Nc4ccc5scnc5c4)n3)cc2)CC1 |
| InChI | InChI=1S/C23H24BrN7S/c1-2-30-9-11-31(12-10-30)18-6-3-16(4-7-18)28-23-25-14-19(24)22(29-23)27-17-5-8-21-20(13-17)26-15-32-21/h3-8,13-15H,2,9-12H2,1H3,(H2,25,27,28,29) |
| InChIKey | VVCCSKGKBRBFTP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|