C24H27ClN8OS — CID 46843695
6-[[5-chloro-2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-4-methylpyrido[3,2-b][1,4]thiazin-3-one (PubChem CID 46843695) has the molecular formula C24H27ClN8OS and a molecular weight of 511.06 g/mol. Its IUPAC name is 6-[[5-chloro-2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-4-methylpyrido[3,2-b][1,4]thiazin-3-one.
| Compound Name | 6-[[5-chloro-2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-4-methylpyrido[3,2-b][1,4]thiazin-3-one |
|---|---|
| PubChem CID | 46843695 |
| Molecular Formula | C24H27ClN8OS |
| Molecular Weight | 511.06 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 6-[[5-chloro-2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-4-methylpyrido[3,2-b][1,4]thiazin-3-one |
| SMILES | CCN1CCN(c2ccc(Nc3ncc(Cl)c(Nc4ccc5c(n4)N(C)C(=O)CS5)n3)cc2)CC1 |
| InChI | InChI=1S/C24H27ClN8OS/c1-3-32-10-12-33(13-11-32)17-6-4-16(5-7-17)27-24-26-14-18(25)22(30-24)28-20-9-8-19-23(29-20)31(2)21(34)15-35-19/h4-9,14H,3,10-13,15H2,1-2H3,(H2,26,27,28,29,30) |
| InChIKey | FBFJOZIMOYNORZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.06 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|