C26H29N7O — CID 155313075
2-[4-(4-ethylpiperazin-1-yl)anilino]-5-methyl-6a,7-dihydroindolo[2,1-h]pteridin-6-one (PubChem CID 155313075) has the molecular formula C26H29N7O and a molecular weight of 455.57 g/mol. Its IUPAC name is 2-[4-(4-ethylpiperazin-1-yl)anilino]-5-methyl-6a,7-dihydroindolo[2,1-h]pteridin-6-one.
| Compound Name | 2-[4-(4-ethylpiperazin-1-yl)anilino]-5-methyl-6a,7-dihydroindolo[2,1-h]pteridin-6-one |
|---|---|
| PubChem CID | 155313075 |
| Molecular Formula | C26H29N7O |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 2-[4-(4-ethylpiperazin-1-yl)anilino]-5-methyl-6a,7-dihydroindolo[2,1-h]pteridin-6-one |
| SMILES | CCN1CCN(c2ccc(Nc3ncc4c(n3)N3c5ccccc5CC3C(=O)N4C)cc2)CC1 |
| InChI | InChI=1S/C26H29N7O/c1-3-31-12-14-32(15-13-31)20-10-8-19(9-11-20)28-26-27-17-23-24(29-26)33-21-7-5-4-6-18(21)16-22(33)25(34)30(23)2/h4-11,17,22H,3,12-16H2,1-2H3,(H,27,28,29) |
| InChIKey | NYVKNQANWJACRG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|