C23H31N7O2 — CID 69187487
1-cyclopentyl-2-ethyl-4-methyl-7-(4-morpholin-4-ylanilino)pyrimido[5,4-e][1,2,4]triazin-3-one (PubChem CID 69187487) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 1-cyclopentyl-2-ethyl-4-methyl-7-(4-morpholin-4-ylanilino)pyrimido[5,4-e][1,2,4]triazin-3-one.
| Compound Name | 1-cyclopentyl-2-ethyl-4-methyl-7-(4-morpholin-4-ylanilino)pyrimido[5,4-e][1,2,4]triazin-3-one |
|---|---|
| PubChem CID | 69187487 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-cyclopentyl-2-ethyl-4-methyl-7-(4-morpholin-4-ylanilino)pyrimido[5,4-e][1,2,4]triazin-3-one |
| SMILES | CCN1C(=O)N(C)c2cnc(Nc3ccc(N4CCOCC4)cc3)nc2N1C1CCCC1 |
| InChI | InChI=1S/C23H31N7O2/c1-3-29-23(31)27(2)20-16-24-22(26-21(20)30(29)19-6-4-5-7-19)25-17-8-10-18(11-9-17)28-12-14-32-15-13-28/h8-11,16,19H,3-7,12-15H2,1-2H3,(H,24,25,26) |
| InChIKey | XJWMURMOQNOGKQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|