C23H30ClN7O2 — CID 69188280
7-(3-chloro-4-morpholin-4-ylanilino)-1-cyclopentyl-2-ethyl-4-methylpyrimido[5,4-e][1,2,4]triazin-3-one (PubChem CID 69188280) has the molecular formula C23H30ClN7O2 and a molecular weight of 471.99 g/mol. Its IUPAC name is 7-(3-chloro-4-morpholin-4-ylanilino)-1-cyclopentyl-2-ethyl-4-methylpyrimido[5,4-e][1,2,4]triazin-3-one.
| Compound Name | 7-(3-chloro-4-morpholin-4-ylanilino)-1-cyclopentyl-2-ethyl-4-methylpyrimido[5,4-e][1,2,4]triazin-3-one |
|---|---|
| PubChem CID | 69188280 |
| Molecular Formula | C23H30ClN7O2 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 7-(3-chloro-4-morpholin-4-ylanilino)-1-cyclopentyl-2-ethyl-4-methylpyrimido[5,4-e][1,2,4]triazin-3-one |
| SMILES | CCN1C(=O)N(C)c2cnc(Nc3ccc(N4CCOCC4)c(Cl)c3)nc2N1C1CCCC1 |
| InChI | InChI=1S/C23H30ClN7O2/c1-3-30-23(32)28(2)20-15-25-22(27-21(20)31(30)17-6-4-5-7-17)26-16-8-9-19(18(24)14-16)29-10-12-33-13-11-29/h8-9,14-15,17H,3-7,10-13H2,1-2H3,(H,25,26,27) |
| InChIKey | KJYNOBDWOGGJAL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|