C31H41ClN6O2 — CID 10281305
2-[3-chloro-4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 10281305) has the molecular formula C31H41ClN6O2 and a molecular weight of 565.16 g/mol. Its IUPAC name is 2-[3-chloro-4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[3-chloro-4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 10281305 |
| Molecular Formula | C31H41ClN6O2 |
| Molecular Weight | 565.16 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | 2-[3-chloro-4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n(C2CCCC2)c2nc(Nc3ccc(N4CCC(CCCN5CCOCC5)CC4)c(Cl)c3)ncc12 |
| InChI | InChI=1S/C31H41ClN6O2/c1-22-19-29(39)38(25-6-2-3-7-25)30-26(22)21-33-31(35-30)34-24-8-9-28(27(32)20-24)37-13-10-23(11-14-37)5-4-12-36-15-17-40-18-16-36/h8-9,19-21,23,25H,2-7,10-18H2,1H3,(H,33,34,35) |
| InChIKey | UMRKCQZAEYFMEB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.16 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|