C29H41N7O2 — CID 68859625
8-cyclopentyl-2-[4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one (PubChem CID 68859625) has the molecular formula C29H41N7O2 and a molecular weight of 519.69 g/mol. Its IUPAC name is 8-cyclopentyl-2-[4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-2-[4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 68859625 |
| Molecular Formula | C29H41N7O2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.33 |
| IUPAC Name | 8-cyclopentyl-2-[4-[4-(3-morpholin-4-ylpropyl)piperidin-1-yl]anilino]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one |
| SMILES | O=C1NCc2cnc(Nc3ccc(N4CCC(CCCN5CCOCC5)CC4)cc3)nc2N1C1CCCC1 |
| InChI | InChI=1S/C29H41N7O2/c37-29-31-21-23-20-30-28(33-27(23)36(29)26-5-1-2-6-26)32-24-7-9-25(10-8-24)35-14-11-22(12-15-35)4-3-13-34-16-18-38-19-17-34/h7-10,20,22,26H,1-6,11-19,21H2,(H,31,37)(H,30,32,33) |
| InChIKey | UPIGERJRWODEQL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|