C21H25N5O3S — CID 10127168
1-cyclopentyl-N-(4-morpholin-4-ylphenyl)-2,2-dioxopyrimido[4,5-c]thiazin-7-amine (PubChem CID 10127168) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is 1-cyclopentyl-N-(4-morpholin-4-ylphenyl)-2,2-dioxopyrimido[4,5-c]thiazin-7-amine.
| Compound Name | 1-cyclopentyl-N-(4-morpholin-4-ylphenyl)-2,2-dioxopyrimido[4,5-c]thiazin-7-amine |
|---|---|
| PubChem CID | 10127168 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-cyclopentyl-N-(4-morpholin-4-ylphenyl)-2,2-dioxopyrimido[4,5-c]thiazin-7-amine |
| SMILES | O=S1(=O)C=Cc2cnc(Nc3ccc(N4CCOCC4)cc3)nc2N1C1CCCC1 |
| InChI | InChI=1S/C21H25N5O3S/c27-30(28)14-9-16-15-22-21(24-20(16)26(30)19-3-1-2-4-19)23-17-5-7-18(8-6-17)25-10-12-29-13-11-25/h5-9,14-15,19H,1-4,10-13H2,(H,22,23,24) |
| InChIKey | UKHOBCDWIGKOFO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|