C27H37N7O2 — CID 154974412
11-cyclopentyl-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-5,6,7,8-tetrahydropyrimido[4,5-e][1,4]diazonine-9,10-dione (PubChem CID 154974412) has the molecular formula C27H37N7O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 11-cyclopentyl-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-5,6,7,8-tetrahydropyrimido[4,5-e][1,4]diazonine-9,10-dione.
| Compound Name | 11-cyclopentyl-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-5,6,7,8-tetrahydropyrimido[4,5-e][1,4]diazonine-9,10-dione |
|---|---|
| PubChem CID | 154974412 |
| Molecular Formula | C27H37N7O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 11-cyclopentyl-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-5,6,7,8-tetrahydropyrimido[4,5-e][1,4]diazonine-9,10-dione |
| SMILES | CC(C)N1CCN(c2ccc(Nc3ncc4c(n3)N(C3CCCC3)C(=O)C(=O)NCCC4)cc2)CC1 |
| InChI | InChI=1S/C27H37N7O2/c1-19(2)32-14-16-33(17-15-32)22-11-9-21(10-12-22)30-27-29-18-20-6-5-13-28-25(35)26(36)34(24(20)31-27)23-7-3-4-8-23/h9-12,18-19,23H,3-8,13-17H2,1-2H3,(H,28,35)(H,29,30,31) |
| InChIKey | PFIAENJYQXTLOS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|