C27H34FN7O2 — CID 154963600
1'-cyclopentyl-2-[3-fluoro-4-(4-propan-2-ylpiperazin-1-yl)anilino]spiro[5,7-dihydropyrrolo[2,3-d]pyrimidine-6,3'-pyrrolidine]-2',5'-dione (PubChem CID 154963600) has the molecular formula C27H34FN7O2 and a molecular weight of 507.61 g/mol. Its IUPAC name is 1'-cyclopentyl-2-[3-fluoro-4-(4-propan-2-ylpiperazin-1-yl)anilino]spiro[5,7-dihydropyrrolo[2,3-d]pyrimidine-6,3'-pyrrolidine]-2',5'-dione.
| Compound Name | 1'-cyclopentyl-2-[3-fluoro-4-(4-propan-2-ylpiperazin-1-yl)anilino]spiro[5,7-dihydropyrrolo[2,3-d]pyrimidine-6,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 154963600 |
| Molecular Formula | C27H34FN7O2 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | 1'-cyclopentyl-2-[3-fluoro-4-(4-propan-2-ylpiperazin-1-yl)anilino]spiro[5,7-dihydropyrrolo[2,3-d]pyrimidine-6,3'-pyrrolidine]-2',5'-dione |
| SMILES | CC(C)N1CCN(c2ccc(Nc3ncc4c(n3)NC3(CC(=O)N(C5CCCC5)C3=O)C4)cc2F)CC1 |
| InChI | InChI=1S/C27H34FN7O2/c1-17(2)33-9-11-34(12-10-33)22-8-7-19(13-21(22)28)30-26-29-16-18-14-27(32-24(18)31-26)15-23(36)35(25(27)37)20-5-3-4-6-20/h7-8,13,16-17,20H,3-6,9-12,14-15H2,1-2H3,(H2,29,30,31,32) |
| InChIKey | JSVNDADYFMTRSY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|