C29H34FN7O2 — CID 167351301
(6S)-8-(1-bicyclo[1.1.1]pentanyl)-2-[3-fluoro-4-(2-propan-2-yl-2,6-diazaspiro[3.3]heptan-6-yl)anilino]spiro[5H-pyrido[2,3-d]pyrimidine-6,3'-pyrrolidine]-2',7-dione (PubChem CID 167351301) has the molecular formula C29H34FN7O2 and a molecular weight of 531.64 g/mol. Its IUPAC name is (6S)-8-(1-bicyclo[1.1.1]pentanyl)-2-[3-fluoro-4-(2-propan-2-yl-2,6-diazaspiro[3.3]heptan-6-yl)anilino]spiro[5H-pyrido[2,3-d]pyrimidine-6,3'-pyrrolidine]-2',7-dione.
| Compound Name | (6S)-8-(1-bicyclo[1.1.1]pentanyl)-2-[3-fluoro-4-(2-propan-2-yl-2,6-diazaspiro[3.3]heptan-6-yl)anilino]spiro[5H-pyrido[2,3-d]pyrimidine-6,3'-pyrrolidine]-2',7-dione |
|---|---|
| PubChem CID | 167351301 |
| Molecular Formula | C29H34FN7O2 |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | (6S)-8-(1-bicyclo[1.1.1]pentanyl)-2-[3-fluoro-4-(2-propan-2-yl-2,6-diazaspiro[3.3]heptan-6-yl)anilino]spiro[5H-pyrido[2,3-d]pyrimidine-6,3'-pyrrolidine]-2',7-dione |
| SMILES | CC(C)N1CC2(CN(c3ccc(Nc4ncc5c(n4)N(C46CC(C4)C6)C(=O)[C@]4(CCNC4=O)C5)cc3F)C2)C1 |
| InChI | InChI=1S/C29H34FN7O2/c1-17(2)35-13-27(14-35)15-36(16-27)22-4-3-20(7-21(22)30)33-26-32-12-19-11-29(5-6-31-24(29)38)25(39)37(23(19)34-26)28-8-18(9-28)10-28/h3-4,7,12,17-18H,5-6,8-11,13-16H2,1-2H3,(H,31,38)(H,32,33,34)/t18?,28?,29-/m1/s1 |
| InChIKey | XKFYCFUJIUNJEB-UDCNVTLVSA-N |
| XLogP | 2.84 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|