C25H32N6O3 — CID 154974255
(6S)-8-cyclopentyl-2-[4-[2-(dimethylamino)ethoxy]anilino]spiro[5H-pyrido[2,3-d]pyrimidine-6,3'-pyrrolidine]-2',7-dione (PubChem CID 154974255) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is (6S)-8-cyclopentyl-2-[4-[2-(dimethylamino)ethoxy]anilino]spiro[5H-pyrido[2,3-d]pyrimidine-6,3'-pyrrolidine]-2',7-dione.
| Compound Name | (6S)-8-cyclopentyl-2-[4-[2-(dimethylamino)ethoxy]anilino]spiro[5H-pyrido[2,3-d]pyrimidine-6,3'-pyrrolidine]-2',7-dione |
|---|---|
| PubChem CID | 154974255 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | (6S)-8-cyclopentyl-2-[4-[2-(dimethylamino)ethoxy]anilino]spiro[5H-pyrido[2,3-d]pyrimidine-6,3'-pyrrolidine]-2',7-dione |
| SMILES | CN(C)CCOc1ccc(Nc2ncc3c(n2)N(C2CCCC2)C(=O)[C@]2(CCNC2=O)C3)cc1 |
| InChI | InChI=1S/C25H32N6O3/c1-30(2)13-14-34-20-9-7-18(8-10-20)28-24-27-16-17-15-25(11-12-26-22(25)32)23(33)31(21(17)29-24)19-5-3-4-6-19/h7-10,16,19H,3-6,11-15H2,1-2H3,(H,26,32)(H,27,28,29)/t25-/m1/s1 |
| InChIKey | MHMFWSLOJNFKMQ-RUZDIDTESA-N |
| XLogP | 2.50 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|