C25H33N5O4 — CID 10276758
2-[4-[2-(dimethylamino)ethoxy]anilino]-8-[3-(oxan-2-yloxy)propyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 10276758) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[4-[2-(dimethylamino)ethoxy]anilino]-8-[3-(oxan-2-yloxy)propyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-[2-(dimethylamino)ethoxy]anilino]-8-[3-(oxan-2-yloxy)propyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 10276758 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 2-[4-[2-(dimethylamino)ethoxy]anilino]-8-[3-(oxan-2-yloxy)propyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN(C)CCOc1ccc(Nc2ncc3ccc(=O)n(CCCOC4CCCCO4)c3n2)cc1 |
| InChI | InChI=1S/C25H33N5O4/c1-29(2)14-17-32-21-10-8-20(9-11-21)27-25-26-18-19-7-12-22(31)30(24(19)28-25)13-5-16-34-23-6-3-4-15-33-23/h7-12,18,23H,3-6,13-17H2,1-2H3,(H,26,27,28) |
| InChIKey | GJYUTMWCBQLQJC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|