C18H25N3O4 — CID 21073385
4,8-dimethyl-2-[4-(oxan-2-yloxy)butoxy]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 21073385) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4,8-dimethyl-2-[4-(oxan-2-yloxy)butoxy]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4,8-dimethyl-2-[4-(oxan-2-yloxy)butoxy]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 21073385 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 4,8-dimethyl-2-[4-(oxan-2-yloxy)butoxy]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1nc(OCCCCOC2CCCCO2)nc2c1ccc(=O)n2C |
| InChI | InChI=1S/C18H25N3O4/c1-13-14-8-9-15(22)21(2)17(14)20-18(19-13)25-12-6-5-11-24-16-7-3-4-10-23-16/h8-9,16H,3-7,10-12H2,1-2H3 |
| InChIKey | MNMSYCOVWQAZGX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|