C18H20N6O — CID 162109809
2-(4-aminoanilino)-8-[2-(azetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 162109809) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-(4-aminoanilino)-8-[2-(azetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(4-aminoanilino)-8-[2-(azetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 162109809 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-(4-aminoanilino)-8-[2-(azetidin-3-yl)ethyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Nc1ccc(Nc2ncc3ccc(=O)n(CCC4CNC4)c3n2)cc1 |
| InChI | InChI=1S/C18H20N6O/c19-14-2-4-15(5-3-14)22-18-21-11-13-1-6-16(25)24(17(13)23-18)8-7-12-9-20-10-12/h1-6,11-12,20H,7-10,19H2,(H,21,22,23) |
| InChIKey | OKJJTYUPQLYADL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|