C28H37N5O4 — CID 126706153
1-(oxan-2-yl)-7-[4-[[9-(oxan-2-yl)purin-2-yl]amino]phenoxy]heptan-1-one (PubChem CID 126706153) has the molecular formula C28H37N5O4 and a molecular weight of 507.64 g/mol. Its IUPAC name is 1-(oxan-2-yl)-7-[4-[[9-(oxan-2-yl)purin-2-yl]amino]phenoxy]heptan-1-one.
| Compound Name | 1-(oxan-2-yl)-7-[4-[[9-(oxan-2-yl)purin-2-yl]amino]phenoxy]heptan-1-one |
|---|---|
| PubChem CID | 126706153 |
| Molecular Formula | C28H37N5O4 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | 1-(oxan-2-yl)-7-[4-[[9-(oxan-2-yl)purin-2-yl]amino]phenoxy]heptan-1-one |
| SMILES | O=C(CCCCCCOc1ccc(Nc2ncc3ncn(C4CCCCO4)c3n2)cc1)C1CCCCO1 |
| InChI | InChI=1S/C28H37N5O4/c34-24(25-10-4-7-17-36-25)9-3-1-2-6-16-35-22-14-12-21(13-15-22)31-28-29-19-23-27(32-28)33(20-30-23)26-11-5-8-18-37-26/h12-15,19-20,25-26H,1-11,16-18H2,(H,29,31,32) |
| InChIKey | MRWCJCNKXFMNKS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|