C19H23IN5O3P — CID 126710758
methyl 7-[4-[(9-iodophosphanylpurin-2-yl)amino]phenoxy]heptanoate (PubChem CID 126710758) has the molecular formula C19H23IN5O3P and a molecular weight of 527.30 g/mol. Its IUPAC name is methyl 7-[4-[(9-iodophosphanylpurin-2-yl)amino]phenoxy]heptanoate.
| Compound Name | methyl 7-[4-[(9-iodophosphanylpurin-2-yl)amino]phenoxy]heptanoate |
|---|---|
| PubChem CID | 126710758 |
| Molecular Formula | C19H23IN5O3P |
| Molecular Weight | 527.30 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | methyl 7-[4-[(9-iodophosphanylpurin-2-yl)amino]phenoxy]heptanoate |
| SMILES | COC(=O)CCCCCCOc1ccc(Nc2ncc3ncn(PI)c3n2)cc1 |
| InChI | InChI=1S/C19H23IN5O3P/c1-27-17(26)6-4-2-3-5-11-28-15-9-7-14(8-10-15)23-19-21-12-16-18(24-19)25(29-20)13-22-16/h7-10,12-13,29H,2-6,11H2,1H3,(H,21,23,24) |
| InChIKey | VUJVSGNWMLDLGK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|