C26H34N6O3 — CID 163209787
methyl 7-[4-[[4-(1-cyclohexyltriazol-4-yl)pyrimidin-2-yl]amino]phenoxy]heptanoate (PubChem CID 163209787) has the molecular formula C26H34N6O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is methyl 7-[4-[[4-(1-cyclohexyltriazol-4-yl)pyrimidin-2-yl]amino]phenoxy]heptanoate.
| Compound Name | methyl 7-[4-[[4-(1-cyclohexyltriazol-4-yl)pyrimidin-2-yl]amino]phenoxy]heptanoate |
|---|---|
| PubChem CID | 163209787 |
| Molecular Formula | C26H34N6O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | methyl 7-[4-[[4-(1-cyclohexyltriazol-4-yl)pyrimidin-2-yl]amino]phenoxy]heptanoate |
| SMILES | COC(=O)CCCCCCOc1ccc(Nc2nccc(-c3cn(C4CCCCC4)nn3)n2)cc1 |
| InChI | InChI=1S/C26H34N6O3/c1-34-25(33)11-7-2-3-8-18-35-22-14-12-20(13-15-22)28-26-27-17-16-23(29-26)24-19-32(31-30-24)21-9-5-4-6-10-21/h12-17,19,21H,2-11,18H2,1H3,(H,27,28,29) |
| InChIKey | DEUDGCBAVYOSAL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|