C26H35IN5O3P — CID 126710787
methyl 7-[4-[[4-(cyclohexylamino)-1-iodophosphanylimidazo[4,5-c]pyridin-6-yl]amino]phenoxy]heptanoate (PubChem CID 126710787) has the molecular formula C26H35IN5O3P and a molecular weight of 623.48 g/mol. Its IUPAC name is methyl 7-[4-[[4-(cyclohexylamino)-1-iodophosphanylimidazo[4,5-c]pyridin-6-yl]amino]phenoxy]heptanoate.
| Compound Name | methyl 7-[4-[[4-(cyclohexylamino)-1-iodophosphanylimidazo[4,5-c]pyridin-6-yl]amino]phenoxy]heptanoate |
|---|---|
| PubChem CID | 126710787 |
| Molecular Formula | C26H35IN5O3P |
| Molecular Weight | 623.48 g/mol |
| Exact Mass | 623.15 |
| IUPAC Name | methyl 7-[4-[[4-(cyclohexylamino)-1-iodophosphanylimidazo[4,5-c]pyridin-6-yl]amino]phenoxy]heptanoate |
| SMILES | COC(=O)CCCCCCOc1ccc(Nc2cc3c(ncn3PI)c(NC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C26H35IN5O3P/c1-34-24(33)11-7-2-3-8-16-35-21-14-12-20(13-15-21)29-23-17-22-25(28-18-32(22)36-27)26(31-23)30-19-9-5-4-6-10-19/h12-15,17-19,36H,2-11,16H2,1H3,(H2,29,30,31) |
| InChIKey | VLTGZHRPJYOBQR-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.48 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|